C36H40N4O3 — CID 171829209
3-[7-[(3-benzhydryl-3,9-diazaspiro[5.5]undecan-9-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171829209) has the molecular formula C36H40N4O3 and a molecular weight of 576.74 g/mol. Its IUPAC name is 3-[7-[(3-benzhydryl-3,9-diazaspiro[5.5]undecan-9-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[(3-benzhydryl-3,9-diazaspiro[5.5]undecan-9-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171829209 |
| Molecular Formula | C36H40N4O3 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 3-[7-[(3-benzhydryl-3,9-diazaspiro[5.5]undecan-9-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CN4CCC5(CC4)CCN(C(c4ccccc4)c4ccccc4)CC5)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C36H40N4O3/c41-32-15-14-31(34(42)37-32)40-25-30-28(12-7-13-29(30)35(40)43)24-38-20-16-36(17-21-38)18-22-39(23-19-36)33(26-8-3-1-4-9-26)27-10-5-2-6-11-27/h1-13,31,33H,14-25H2,(H,37,41,42) |
| InChIKey | NYAJMINRYXADPV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|