C28H29N5O3 — CID 169311410
2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2,7-diazaspiro[3.5]nonan-7-yl]methyl]benzonitrile (PubChem CID 169311410) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2,7-diazaspiro[3.5]nonan-7-yl]methyl]benzonitrile.
| Compound Name | 2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2,7-diazaspiro[3.5]nonan-7-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 169311410 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 2-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2,7-diazaspiro[3.5]nonan-7-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1CCC2(CC1)CN(c1cccc3c1CN(C1CCC(=O)NC1=O)C3=O)C2 |
| InChI | InChI=1S/C28H29N5O3/c29-14-19-4-1-2-5-20(19)15-31-12-10-28(11-13-31)17-32(18-28)23-7-3-6-21-22(23)16-33(27(21)36)24-8-9-25(34)30-26(24)35/h1-7,24H,8-13,15-18H2,(H,30,34,35) |
| InChIKey | AOYIETBCLIFALX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|