C19H21N3O4 — CID 165136850
1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]piperidine-4-carbaldehyde (PubChem CID 165136850) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]piperidine-4-carbaldehyde.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 165136850 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C19H21N3O4/c23-11-12-6-8-21(9-7-12)15-3-1-2-13-14(15)10-22(19(13)26)16-4-5-17(24)20-18(16)25/h1-3,11-12,16H,4-10H2,(H,20,24,25) |
| InChIKey | FVZMMCCUZPNOEL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|