C29H34N6O3 — CID 166143414
3-[7-[6-[1-(4-aminophenyl)piperidin-4-yl]-2,6-diazaspiro[3.3]heptan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166143414) has the molecular formula C29H34N6O3 and a molecular weight of 514.63 g/mol. Its IUPAC name is 3-[7-[6-[1-(4-aminophenyl)piperidin-4-yl]-2,6-diazaspiro[3.3]heptan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[6-[1-(4-aminophenyl)piperidin-4-yl]-2,6-diazaspiro[3.3]heptan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166143414 |
| Molecular Formula | C29H34N6O3 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 3-[7-[6-[1-(4-aminophenyl)piperidin-4-yl]-2,6-diazaspiro[3.3]heptan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Nc1ccc(N2CCC(N3CC4(CN(c5cccc6c5CN(C5CCC(=O)NC5=O)C6=O)C4)C3)CC2)cc1 |
| InChI | InChI=1S/C29H34N6O3/c30-19-4-6-20(7-5-19)32-12-10-21(11-13-32)33-15-29(16-33)17-34(18-29)24-3-1-2-22-23(24)14-35(28(22)38)25-8-9-26(36)31-27(25)37/h1-7,21,25H,8-18,30H2,(H,31,36,37) |
| InChIKey | RAQZWCZUKZTQKW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|