C29H33Cl2N5O3 — CID 177163399
3-[7-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177163399) has the molecular formula C29H33Cl2N5O3 and a molecular weight of 570.52 g/mol. Its IUPAC name is 3-[7-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177163399 |
| Molecular Formula | C29H33Cl2N5O3 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 3-[7-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CN4CCC(N5CCN(c6cccc(Cl)c6Cl)CC5)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H33Cl2N5O3/c30-23-5-2-6-24(27(23)31)35-15-13-34(14-16-35)20-9-11-33(12-10-20)17-19-3-1-4-21-22(19)18-36(29(21)39)25-7-8-26(37)32-28(25)38/h1-6,20,25H,7-18H2,(H,32,37,38) |
| InChIKey | CXKSBEZTCPSEKC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|