C24H33N5O3 — CID 167716275
3-[3-oxo-7-[[(1-piperidin-4-ylpiperidin-4-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167716275) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 3-[3-oxo-7-[[(1-piperidin-4-ylpiperidin-4-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[[(1-piperidin-4-ylpiperidin-4-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167716275 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 3-[3-oxo-7-[[(1-piperidin-4-ylpiperidin-4-yl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CNC4CCN(C5CCNCC5)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H33N5O3/c30-22-5-4-21(23(31)27-22)29-15-20-16(2-1-3-19(20)24(29)32)14-26-17-8-12-28(13-9-17)18-6-10-25-11-7-18/h1-3,17-18,21,25-26H,4-15H2,(H,27,30,31) |
| InChIKey | ORKQXVYQJANROA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|