C19H20N6O3 — CID 167780386
3-[7-[4-(1-aminocyclobutyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167780386) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 3-[7-[4-(1-aminocyclobutyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-(1-aminocyclobutyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167780386 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3-[7-[4-(1-aminocyclobutyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NC1(c2cn(-c3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)nn2)CCC1 |
| InChI | InChI=1S/C19H20N6O3/c20-19(7-2-8-19)15-10-25(23-22-15)13-4-1-3-11-12(13)9-24(18(11)28)14-5-6-16(26)21-17(14)27/h1,3-4,10,14H,2,5-9,20H2,(H,21,26,27) |
| InChIKey | RMETXVUXVCXQMO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|