C20H23ClN6O3 — CID 166423035
3-[3-oxo-7-[4-[(2S)-piperidin-2-yl]triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 166423035) has the molecular formula C20H23ClN6O3 and a molecular weight of 430.90 g/mol. Its IUPAC name is 3-[3-oxo-7-[4-[(2S)-piperidin-2-yl]triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[3-oxo-7-[4-[(2S)-piperidin-2-yl]triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 166423035 |
| Molecular Formula | C20H23ClN6O3 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3-[3-oxo-7-[4-[(2S)-piperidin-2-yl]triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(N2Cc3c(cccc3-n3cc([C@@H]4CCCCN4)nn3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H22N6O3.ClH/c27-18-8-7-17(19(28)22-18)25-10-13-12(20(25)29)4-3-6-16(13)26-11-15(23-24-26)14-5-1-2-9-21-14;/h3-4,6,11,14,17,21H,1-2,5,7-10H2,(H,22,27,28);1H/t14-,17?;/m0./s1 |
| InChIKey | IPQLNPDLJKCVOF-CDCITTPHSA-N |
| XLogP | 1.26 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|