C21H22N6O5 — CID 167931240
3-[7-[4-(3-methoxypyrrolidine-1-carbonyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167931240) has the molecular formula C21H22N6O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is 3-[7-[4-(3-methoxypyrrolidine-1-carbonyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-(3-methoxypyrrolidine-1-carbonyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167931240 |
| Molecular Formula | C21H22N6O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[7-[4-(3-methoxypyrrolidine-1-carbonyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COC1CCN(C(=O)c2cn(-c3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)nn2)C1 |
| InChI | InChI=1S/C21H22N6O5/c1-32-12-7-8-25(9-12)21(31)15-11-27(24-23-15)16-4-2-3-13-14(16)10-26(20(13)30)17-5-6-18(28)22-19(17)29/h2-4,11-12,17H,5-10H2,1H3,(H,22,28,29) |
| InChIKey | DZZRDZLLDQFQPA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|