C25H20F3N3O5 — CID 155316184
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-oxo-2-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]acetamide (PubChem CID 155316184) has the molecular formula C25H20F3N3O5 and a molecular weight of 499.45 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-oxo-2-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]acetamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-oxo-2-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]acetamide |
|---|---|
| PubChem CID | 155316184 |
| Molecular Formula | C25H20F3N3O5 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2-oxo-2-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]acetamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)C(=O)c4ccc(C5(C(F)(F)F)CC5)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H20F3N3O5/c26-25(27,28)24(10-11-24)14-6-4-13(5-7-14)20(33)22(35)29-17-3-1-2-15-16(17)12-31(23(15)36)18-8-9-19(32)30-21(18)34/h1-7,18H,8-12H2,(H,29,35)(H,30,32,34) |
| InChIKey | MACMVYAZBJFSDS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|