C17H17N3O4 — CID 167989554
(E)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-2-enamide (PubChem CID 167989554) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is (E)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-2-enamide.
| Compound Name | (E)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-2-enamide |
|---|---|
| PubChem CID | 167989554 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (E)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C17H17N3O4/c1-2-4-14(21)18-12-6-3-5-10-11(12)9-20(17(10)24)13-7-8-15(22)19-16(13)23/h2-6,13H,7-9H2,1H3,(H,18,21)(H,19,22,23)/b4-2+ |
| InChIKey | FKFSXQDZLXPRFI-DUXPYHPUSA-N |
| XLogP | 0.96 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|