C18H14FN3O4S — CID 166425662
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-5-fluorothiophene-2-carboxamide (PubChem CID 166425662) has the molecular formula C18H14FN3O4S and a molecular weight of 387.39 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-5-fluorothiophene-2-carboxamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-5-fluorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 166425662 |
| Molecular Formula | C18H14FN3O4S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-5-fluorothiophene-2-carboxamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)c4ccc(F)s4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H14FN3O4S/c19-14-6-5-13(27-14)17(25)20-11-3-1-2-9-10(11)8-22(18(9)26)12-4-7-15(23)21-16(12)24/h1-3,5-6,12H,4,7-8H2,(H,20,25)(H,21,23,24) |
| InChIKey | LNDOMTLQTFUJGN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|