C20H15F2N3O4 — CID 154810843
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2,4-difluorobenzamide (PubChem CID 154810843) has the molecular formula C20H15F2N3O4 and a molecular weight of 399.35 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2,4-difluorobenzamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 154810843 |
| Molecular Formula | C20H15F2N3O4 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-2,4-difluorobenzamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)c4ccc(F)cc4F)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H15F2N3O4/c21-10-4-5-12(14(22)8-10)18(27)23-15-3-1-2-11-13(15)9-25(20(11)29)16-6-7-17(26)24-19(16)28/h1-5,8,16H,6-7,9H2,(H,23,27)(H,24,26,28) |
| InChIKey | NAUGUECGJGRBAZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|