C19H21F3N4O6 — CID 175815332
4-amino-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 175815332) has the molecular formula C19H21F3N4O6 and a molecular weight of 458.39 g/mol. Its IUPAC name is 4-amino-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-amino-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175815332 |
| Molecular Formula | C19H21F3N4O6 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 4-amino-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20N4O4.C2HF3O2/c18-8-2-5-14(22)19-12-4-1-3-10-11(12)9-21(17(10)25)13-6-7-15(23)20-16(13)24;3-2(4,5)1(6)7/h1,3-4,13H,2,5-9,18H2,(H,19,22)(H,20,23,24);(H,6,7) |
| InChIKey | GOVPCDGSRBUVNM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|