C28H41N5O6 — CID 162489649
tert-butyl N-(3-aminopropyl)-N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-7-oxoheptyl]carbamate (PubChem CID 162489649) has the molecular formula C28H41N5O6 and a molecular weight of 543.67 g/mol. Its IUPAC name is tert-butyl N-(3-aminopropyl)-N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-7-oxoheptyl]carbamate.
| Compound Name | tert-butyl N-(3-aminopropyl)-N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-7-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 162489649 |
| Molecular Formula | C28H41N5O6 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | tert-butyl N-(3-aminopropyl)-N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-7-oxoheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCN)CCCCCCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C28H41N5O6/c1-28(2,3)39-27(38)32(17-9-15-29)16-7-5-4-6-12-23(34)30-21-11-8-10-19-20(21)18-33(26(19)37)22-13-14-24(35)31-25(22)36/h8,10-11,22H,4-7,9,12-18,29H2,1-3H3,(H,30,34)(H,31,35,36) |
| InChIKey | QDCQSQUKZVZEOJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|