C30H43N5O7 — CID 168832710
tert-butyl N-(4-aminocyclohexyl)-N-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethoxy]butyl]carbamate (PubChem CID 168832710) has the molecular formula C30H43N5O7 and a molecular weight of 585.70 g/mol. Its IUPAC name is tert-butyl N-(4-aminocyclohexyl)-N-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethoxy]butyl]carbamate.
| Compound Name | tert-butyl N-(4-aminocyclohexyl)-N-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethoxy]butyl]carbamate |
|---|---|
| PubChem CID | 168832710 |
| Molecular Formula | C30H43N5O7 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | tert-butyl N-(4-aminocyclohexyl)-N-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethoxy]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCOCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)C1CCC(N)CC1 |
| InChI | InChI=1S/C30H43N5O7/c1-30(2,3)42-29(40)34(20-11-9-19(31)10-12-20)15-4-5-16-41-18-26(37)32-23-8-6-7-21-22(23)17-35(28(21)39)24-13-14-25(36)33-27(24)38/h6-8,19-20,24H,4-5,9-18,31H2,1-3H3,(H,32,37)(H,33,36,38) |
| InChIKey | OCPZNASHWYQOGL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|