C25H34N4O7 — CID 166714911
tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethyl]-N-(2-propoxyethyl)carbamate (PubChem CID 166714911) has the molecular formula C25H34N4O7 and a molecular weight of 502.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethyl]-N-(2-propoxyethyl)carbamate.
| Compound Name | tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethyl]-N-(2-propoxyethyl)carbamate |
|---|---|
| PubChem CID | 166714911 |
| Molecular Formula | C25H34N4O7 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | tert-butyl N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethyl]-N-(2-propoxyethyl)carbamate |
| SMILES | CCCOCCN(CC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H34N4O7/c1-5-12-35-13-11-28(24(34)36-25(2,3)4)15-21(31)26-18-8-6-7-16-17(18)14-29(23(16)33)19-9-10-20(30)27-22(19)32/h6-8,19H,5,9-15H2,1-4H3,(H,26,31)(H,27,30,32) |
| InChIKey | VXIPAQZLUYVUNF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|