C23H29N7O6 — CID 162489607
tert-butyl N-(2-azidoethyl)-N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-3-oxopropyl]carbamate (PubChem CID 162489607) has the molecular formula C23H29N7O6 and a molecular weight of 499.53 g/mol. Its IUPAC name is tert-butyl N-(2-azidoethyl)-N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-(2-azidoethyl)-N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 162489607 |
| Molecular Formula | C23H29N7O6 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | tert-butyl N-(2-azidoethyl)-N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCN=[N+]=[N-])CCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H29N7O6/c1-23(2,3)36-22(35)29(12-10-25-28-24)11-9-19(32)26-16-6-4-5-14-15(16)13-30(21(14)34)17-7-8-18(31)27-20(17)33/h4-6,17H,7-13H2,1-3H3,(H,26,32)(H,27,31,33) |
| InChIKey | OQEZWXRLCSPSFQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 173.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|