C31H42N6O9 — CID 162489446
tert-butyl N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]prop-2-ynyl]carbamate (PubChem CID 162489446) has the molecular formula C31H42N6O9 and a molecular weight of 642.71 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 162489446 |
| Molecular Formula | C31H42N6O9 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]prop-2-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC#Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)CCOCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C31H42N6O9/c1-31(2,3)46-30(41)36(13-15-43-17-19-45-21-20-44-18-16-42-14-11-33-35-32)12-5-7-23-6-4-8-24-25(23)22-37(29(24)40)26-9-10-27(38)34-28(26)39/h4,6,8,26H,9-22H2,1-3H3,(H,34,38,39) |
| InChIKey | PMKSAGHQADHVMB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|