C30H43N7O10 — CID 162489375
tert-butyl N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethyl]carbamate (PubChem CID 162489375) has the molecular formula C30H43N7O10 and a molecular weight of 661.71 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 162489375 |
| Molecular Formula | C30H43N7O10 |
| Molecular Weight | 661.71 g/mol |
| Exact Mass | 661.31 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCOCCOCCOCCOCCN=[N+]=[N-])CC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C30H43N7O10/c1-30(2,3)47-29(42)36(10-12-44-14-16-46-18-17-45-15-13-43-11-9-32-35-31)20-26(39)33-23-6-4-5-21-22(23)19-37(28(21)41)24-7-8-25(38)34-27(24)40/h4-6,24H,7-20H2,1-3H3,(H,33,39)(H,34,38,40) |
| InChIKey | YZCJDCUJDLWJJR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 210.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.71 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|