C28H39N7O9 — CID 168833011
tert-butyl N-[1-[2-(2-azidoethoxy)ethoxy]-3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-3-oxopropoxy]propan-2-yl]carbamate (PubChem CID 168833011) has the molecular formula C28H39N7O9 and a molecular weight of 617.66 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(2-azidoethoxy)ethoxy]-3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-3-oxopropoxy]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(2-azidoethoxy)ethoxy]-3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-3-oxopropoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 168833011 |
| Molecular Formula | C28H39N7O9 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | tert-butyl N-[1-[2-(2-azidoethoxy)ethoxy]-3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-3-oxopropoxy]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(COCCOCCN=[N+]=[N-])COCCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C28H39N7O9/c1-28(2,3)44-27(40)31-18(17-43-14-13-41-12-10-30-34-29)16-42-11-9-24(37)32-21-6-4-5-19-20(21)15-35(26(19)39)22-7-8-23(36)33-25(22)38/h4-6,18,22H,7-17H2,1-3H3,(H,31,40)(H,32,37)(H,33,36,38) |
| InChIKey | OWRGPBBFBBDAJE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 210.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|