C26H37N3O8 — CID 172555990
tert-butyl 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 172555990) has the molecular formula C26H37N3O8 and a molecular weight of 519.60 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 172555990 |
| Molecular Formula | C26H37N3O8 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCNc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H37N3O8/c1-26(2,3)37-23(31)9-11-34-13-15-36-16-14-35-12-10-27-20-6-4-5-18-19(20)17-29(25(18)33)21-7-8-22(30)28-24(21)32/h4-6,21,27H,7-17H2,1-3H3,(H,28,30,32) |
| InChIKey | PVDNUWPMDSXNCD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|