C30H40N4O6 — CID 168832718
tert-butyl N-(4-aminocyclohexyl)-N-[2-[4-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]but-3-ynoxy]ethyl]carbamate (PubChem CID 168832718) has the molecular formula C30H40N4O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is tert-butyl N-(4-aminocyclohexyl)-N-[2-[4-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]but-3-ynoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-(4-aminocyclohexyl)-N-[2-[4-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]but-3-ynoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 168832718 |
| Molecular Formula | C30H40N4O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | tert-butyl N-(4-aminocyclohexyl)-N-[2-[4-[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]but-3-ynoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCOCCC#Cc1cccc2c1CN([C@H]1CCC(=O)NC1=O)C2=O)C1CCC(N)CC1 |
| InChI | InChI=1S/C30H40N4O6/c1-30(2,3)40-29(38)33(22-12-10-21(31)11-13-22)16-18-39-17-5-4-7-20-8-6-9-23-24(20)19-34(28(23)37)25-14-15-26(35)32-27(25)36/h6,8-9,21-22,25H,5,10-19,31H2,1-3H3,(H,32,35,36)/t21?,22?,25-/m0/s1 |
| InChIKey | OXJQHCSCWSTVKX-OWWUNANSSA-N |
| XLogP | 2.71 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|