C27H32N4O5 — CID 172509778
tert-butyl 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (PubChem CID 172509778) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate.
| Compound Name | tert-butyl 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
|---|---|
| PubChem CID | 172509778 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | tert-butyl 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC1CN(CCC#Cc1cccc3c1CN(C1CCC(=O)NC1=O)C3=O)C2 |
| InChI | InChI=1S/C27H32N4O5/c1-27(2,3)36-26(35)31-18-13-19(31)15-29(14-18)12-5-4-7-17-8-6-9-20-21(17)16-30(25(20)34)22-10-11-23(32)28-24(22)33/h6,8-9,18-19,22H,5,10-16H2,1-3H3,(H,28,32,33) |
| InChIKey | FXZSHRIYEFHYCH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|