C24H27N3O7 — CID 168832706
tert-butyl N-[(1R)-1-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynoxy]-2-oxoethyl]carbamate (PubChem CID 168832706) has the molecular formula C24H27N3O7 and a molecular weight of 469.49 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynoxy]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynoxy]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 168832706 |
| Molecular Formula | C24H27N3O7 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | tert-butyl N-[(1R)-1-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynoxy]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C=O)OCCC#Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H27N3O7/c1-24(2,3)34-23(32)26-20(14-28)33-12-5-4-7-15-8-6-9-16-17(15)13-27(22(16)31)18-10-11-19(29)25-21(18)30/h6,8-9,14,18,20H,5,10-13H2,1-3H3,(H,26,32)(H,25,29,30)/t18?,20-/m1/s1 |
| InChIKey | AWAIKEWJCMUBOQ-ROPPNANJSA-N |
| XLogP | 1.26 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|