C28H36N6O7 — CID 168832849
tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]but-3-ynyl]carbamate (PubChem CID 168832849) has the molecular formula C28H36N6O7 and a molecular weight of 568.63 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]but-3-ynyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 168832849 |
| Molecular Formula | C28H36N6O7 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-N-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]but-3-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC#Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)CCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C28H36N6O7/c1-28(2,3)41-27(38)33(13-15-40-17-16-39-14-11-30-32-29)12-5-4-6-20-7-8-22-21(18-20)19-34(26(22)37)23-9-10-24(35)31-25(23)36/h7-8,18,23H,5,9-17,19H2,1-3H3,(H,31,35,36) |
| InChIKey | FCCQSVRXUVXTDD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 163.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|