C30H37N7O5 — CID 176621782
tert-butyl N-(4-azidocyclohexyl)-N-[1-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynyl]azetidin-3-yl]carbamate (PubChem CID 176621782) has the molecular formula C30H37N7O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is tert-butyl N-(4-azidocyclohexyl)-N-[1-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynyl]azetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-(4-azidocyclohexyl)-N-[1-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynyl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 176621782 |
| Molecular Formula | C30H37N7O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | tert-butyl N-(4-azidocyclohexyl)-N-[1-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynyl]azetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C1CCC(N=[N+]=[N-])CC1)C1CN(CC#Cc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C30H37N7O5/c1-30(2,3)42-29(41)37(22-9-7-21(8-10-22)33-34-31)23-17-35(18-23)14-4-5-19-6-11-24-20(15-19)16-36(28(24)40)25-12-13-26(38)32-27(25)39/h6,11,15,21-23,25H,7-10,12-14,16-18H2,1-3H3,(H,32,38,39) |
| InChIKey | BCODESGMMSJYRU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 148.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|