C33H40N6O4 — CID 177318218
4-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynyl]piperazin-1-yl]-N'-hexylbenzohydrazide (PubChem CID 177318218) has the molecular formula C33H40N6O4 and a molecular weight of 584.72 g/mol. Its IUPAC name is 4-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynyl]piperazin-1-yl]-N'-hexylbenzohydrazide.
| Compound Name | 4-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynyl]piperazin-1-yl]-N'-hexylbenzohydrazide |
|---|---|
| PubChem CID | 177318218 |
| Molecular Formula | C33H40N6O4 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 4-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]prop-2-ynyl]piperazin-1-yl]-N'-hexylbenzohydrazide |
| SMILES | CCCCCCNNC(=O)c1ccc(N2CCN(CC#Cc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1 |
| InChI | InChI=1S/C33H40N6O4/c1-2-3-4-5-16-34-36-31(41)25-9-11-27(12-10-25)38-20-18-37(19-21-38)17-6-7-24-8-13-28-26(22-24)23-39(33(28)43)29-14-15-30(40)35-32(29)42/h8-13,22,29,34H,2-5,14-21,23H2,1H3,(H,36,41)(H,35,40,42) |
| InChIKey | DENDEXHPXCREBJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|