C47H53N5O4 — CID 146619197
(3S)-3-[6-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylhex-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146619197) has the molecular formula C47H53N5O4 and a molecular weight of 751.97 g/mol. Its IUPAC name is (3S)-3-[6-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylhex-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[6-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylhex-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146619197 |
| Molecular Formula | C47H53N5O4 |
| Molecular Weight | 751.97 g/mol |
| Exact Mass | 751.41 |
| IUPAC Name | (3S)-3-[6-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylhex-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCCC/C(=C(\c1ccc(O)cc1)c1ccc(N2CCC(CN3CCN(c4ccc5c(c4)CN([C@H]4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C47H53N5O4/c1-2-3-9-41(34-7-5-4-6-8-34)45(36-12-17-40(53)18-13-36)35-10-14-38(15-11-35)50-24-22-33(23-25-50)31-49-26-28-51(29-27-49)39-16-19-42-37(30-39)32-52(47(42)56)43-20-21-44(54)48-46(43)55/h4-8,10-19,30,33,43,53H,2-3,9,20-29,31-32H2,1H3,(H,48,54,55)/b45-41+/t43-/m0/s1 |
| InChIKey | OOFJISBETUPVPE-TYENSZMBSA-N |
| XLogP | 7.34 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.97 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|