C45H50BN5O5 — CID 165407055
[4-[(Z)-1-[4-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid (PubChem CID 165407055) has the molecular formula C45H50BN5O5 and a molecular weight of 751.74 g/mol. Its IUPAC name is [4-[(Z)-1-[4-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid.
| Compound Name | [4-[(Z)-1-[4-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 165407055 |
| Molecular Formula | C45H50BN5O5 |
| Molecular Weight | 751.74 g/mol |
| Exact Mass | 751.39 |
| IUPAC Name | [4-[(Z)-1-[4-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid |
| SMILES | CC/C(=C(\c1ccc(B(O)O)cc1)c1ccc(N2CCC(CN3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C45H50BN5O5/c1-2-39(32-6-4-3-5-7-32)43(33-8-13-36(14-9-33)46(55)56)34-10-15-37(16-11-34)49-22-20-31(21-23-49)29-48-24-26-50(27-25-48)38-17-12-35-30-51(45(54)40(35)28-38)41-18-19-42(52)47-44(41)53/h3-17,28,31,41,55-56H,2,18-27,29-30H2,1H3,(H,47,52,53)/b43-39- |
| InChIKey | XCVISMKVPKASTG-MBJURZOESA-N |
| XLogP | 4.54 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.74 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|