C45H51N5O3 — CID 154975617
3-[5-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 154975617) has the molecular formula C45H51N5O3 and a molecular weight of 709.94 g/mol. Its IUPAC name is 3-[5-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154975617 |
| Molecular Formula | C45H51N5O3 |
| Molecular Weight | 709.94 g/mol |
| Exact Mass | 709.40 |
| IUPAC Name | 3-[5-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(N2CCC(CN3CCN(c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C45H51N5O3/c1-2-41(33-6-4-3-5-7-33)44(35-11-16-40(51)17-12-35)34-8-13-38(14-9-34)48-22-20-32(21-23-48)29-47-24-26-49(27-25-47)39-15-10-36-30-50(31-37(36)28-39)42-18-19-43(52)46-45(42)53/h3-17,28,32,42,51H,2,18-27,29-31H2,1H3,(H,46,52,53)/b44-41+ |
| InChIKey | NXBBGRVDWGCDLA-OEVLCYMMSA-N |
| XLogP | 6.92 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.94 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|