C46H51N5O4 — CID 146566358
3-[6-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]-1-methylpiperidine-2,6-dione (PubChem CID 146566358) has the molecular formula C46H51N5O4 and a molecular weight of 737.95 g/mol. Its IUPAC name is 3-[6-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[6-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 146566358 |
| Molecular Formula | C46H51N5O4 |
| Molecular Weight | 737.95 g/mol |
| Exact Mass | 737.39 |
| IUPAC Name | 3-[6-[4-[[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]-1-methylpiperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(N2CCC(CN3CCN(c4ccc5c(c4)CN(C4CCC(=O)N(C)C4=O)C5=O)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H51N5O4/c1-3-40(33-7-5-4-6-8-33)44(35-11-16-39(52)17-12-35)34-9-13-37(14-10-34)49-23-21-32(22-24-49)30-48-25-27-50(28-26-48)38-15-18-41-36(29-38)31-51(45(41)54)42-19-20-43(53)47(2)46(42)55/h4-18,29,32,42,52H,3,19-28,30-31H2,1-2H3/b44-40+ |
| InChIKey | XXLLDCJMLFUEHO-NECFUIDXSA-N |
| XLogP | 6.90 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.95 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|