C43H46N4O5 — CID 146566239
3-[6-[4-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146566239) has the molecular formula C43H46N4O5 and a molecular weight of 698.86 g/mol. Its IUPAC name is 3-[6-[4-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146566239 |
| Molecular Formula | C43H46N4O5 |
| Molecular Weight | 698.86 g/mol |
| Exact Mass | 698.35 |
| IUPAC Name | 3-[6-[4-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCCCN2CCN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H46N4O5/c1-2-37(30-8-4-3-5-9-30)41(31-10-15-35(48)16-11-31)32-12-17-36(18-13-32)52-27-7-6-22-45-23-25-46(26-24-45)34-14-19-38-33(28-34)29-47(43(38)51)39-20-21-40(49)44-42(39)50/h3-5,8-19,28,39,48H,2,6-7,20-27,29H2,1H3,(H,44,49,50) |
| InChIKey | BDWUUIKRGDECBD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.86 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|