C46H52BN6O5 — CID 166021099
CID 166021099 (PubChem CID 166021099) has the molecular formula C46H52BN6O5 and a molecular weight of 779.77 g/mol.
| Compound Name | CID 166021099 |
|---|---|
| PubChem CID | 166021099 |
| Molecular Formula | C46H52BN6O5 |
| Molecular Weight | 779.77 g/mol |
| Exact Mass | 779.41 |
| IUPAC Name | — |
| SMILES | CC/C(=C(/c1ccc(O[B]O)cc1)c1ccc(N2CCN(CCCN3CCN(c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H52BN6O5/c1-2-40(33-7-4-3-5-8-33)44(35-11-16-39(17-12-35)58-47-57)34-9-13-37(14-10-34)51-27-23-49(24-28-51)21-6-22-50-25-29-52(30-26-50)38-15-18-41-36(31-38)32-53(46(41)56)42-19-20-43(54)48-45(42)55/h3-5,7-18,31,42,57H,2,6,19-30,32H2,1H3,(H,48,54,55)/b44-40- |
| InChIKey | BPZDETCWAHQQQA-ZJWNILRBSA-N |
| XLogP | 5.06 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|