C47H54BN5O6 — CID 165407033
[4-[(E)-1-[4-[2-[4-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-4-yl]methyl]piperazin-1-yl]ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid (PubChem CID 165407033) has the molecular formula C47H54BN5O6 and a molecular weight of 795.79 g/mol. Its IUPAC name is [4-[(E)-1-[4-[2-[4-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-4-yl]methyl]piperazin-1-yl]ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid.
| Compound Name | [4-[(E)-1-[4-[2-[4-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-4-yl]methyl]piperazin-1-yl]ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 165407033 |
| Molecular Formula | C47H54BN5O6 |
| Molecular Weight | 795.79 g/mol |
| Exact Mass | 795.42 |
| IUPAC Name | [4-[(E)-1-[4-[2-[4-[[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-4-yl]methyl]piperazin-1-yl]ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid |
| SMILES | CC/C(=C(\c1ccc(OCCN2CCN(CC3CCN(c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1)c1ccc(B(O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C47H54BN5O6/c1-2-41(34-6-4-3-5-7-34)45(35-8-12-38(13-9-35)48(57)58)36-10-15-40(16-11-36)59-29-28-50-24-26-51(27-25-50)31-33-20-22-52(23-21-33)39-14-17-42-37(30-39)32-53(47(42)56)43-18-19-44(54)49-46(43)55/h3-17,30,33,43,57-58H,2,18-29,31-32H2,1H3,(H,49,54,55)/b45-41+ |
| InChIKey | KNJAMZGBBBEBDI-LYMKOHMFSA-N |
| XLogP | 4.41 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.79 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|