C47H53BN5O6 — CID 166021070
CID 166021070 (PubChem CID 166021070) has the molecular formula C47H53BN5O6 and a molecular weight of 794.78 g/mol.
| Compound Name | CID 166021070 |
|---|---|
| PubChem CID | 166021070 |
| Molecular Formula | C47H53BN5O6 |
| Molecular Weight | 794.78 g/mol |
| Exact Mass | 794.41 |
| IUPAC Name | — |
| SMILES | CC/C(=C(\c1ccc(O[B]O)cc1)c1ccc(OCCN2CCN(CC3CCN(c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C47H53BN5O6/c1-2-41(34-6-4-3-5-7-34)45(36-10-15-40(16-11-36)59-48-57)35-8-13-39(14-9-35)58-29-28-50-24-26-51(27-25-50)31-33-20-22-52(23-21-33)38-12-17-42-37(30-38)32-53(47(42)56)43-18-19-44(54)49-46(43)55/h3-17,30,33,43,57H,2,18-29,31-32H2,1H3,(H,49,54,55)/b45-41+ |
| InChIKey | CKRXTSDTWKBAIO-LYMKOHMFSA-N |
| XLogP | 5.64 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.78 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|