C45H50N4O5 — CID 154964161
3-[6-[5-[4-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]-1,5-diazocan-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154964161) has the molecular formula C45H50N4O5 and a molecular weight of 726.92 g/mol. Its IUPAC name is 3-[6-[5-[4-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]-1,5-diazocan-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-[4-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]-1,5-diazocan-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154964161 |
| Molecular Formula | C45H50N4O5 |
| Molecular Weight | 726.92 g/mol |
| Exact Mass | 726.38 |
| IUPAC Name | 3-[6-[5-[4-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]-1,5-diazocan-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCCCN2CCCN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C45H50N4O5/c1-2-39(32-10-4-3-5-11-32)43(33-12-17-37(50)18-13-33)34-14-19-38(20-15-34)54-29-7-6-24-47-25-8-27-48(28-9-26-47)36-16-21-40-35(30-36)31-49(45(40)53)41-22-23-42(51)46-44(41)52/h3-5,10-21,30,41,50H,2,6-9,22-29,31H2,1H3,(H,46,51,52)/b43-39- |
| InChIKey | OSGKSINDTRAJFC-MBJURZOESA-N |
| XLogP | 7.28 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.92 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|