C44H46N4O6 — CID 146566281
2-(2,6-dioxopiperidin-3-yl)-5-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 146566281) has the molecular formula C44H46N4O6 and a molecular weight of 726.87 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146566281 |
| Molecular Formula | C44H46N4O6 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.34 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCCCCN2CCN(c3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H46N4O6/c1-2-36(30-9-5-3-6-10-30)41(31-11-16-34(49)17-12-31)32-13-18-35(19-14-32)54-28-8-4-7-23-46-24-26-47(27-25-46)33-15-20-37-38(29-33)44(53)48(43(37)52)39-21-22-40(50)45-42(39)51/h3,5-6,9-20,29,39,49H,2,4,7-8,21-28H2,1H3,(H,45,50,51)/b41-36- |
| InChIKey | KGWQEIHSGNNQGN-GYILVKINSA-N |
| XLogP | 6.53 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|