C44H46N2O9 — CID 146566898
2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]propoxy]propoxy]propoxy]isoindole-1,3-dione (PubChem CID 146566898) has the molecular formula C44H46N2O9 and a molecular weight of 746.86 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]propoxy]propoxy]propoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]propoxy]propoxy]propoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146566898 |
| Molecular Formula | C44H46N2O9 |
| Molecular Weight | 746.86 g/mol |
| Exact Mass | 746.32 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]propoxy]propoxy]propoxy]isoindole-1,3-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCCOCCCOCCCOc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H46N2O9/c1-2-36(30-9-4-3-5-10-30)41(31-11-15-33(47)16-12-31)32-13-17-34(18-14-32)54-27-7-25-52-23-6-24-53-26-8-28-55-35-19-20-37-38(29-35)44(51)46(43(37)50)39-21-22-40(48)45-42(39)49/h3-5,9-20,29,39,47H,2,6-8,21-28H2,1H3,(H,45,48,49) |
| InChIKey | DCTILRBRHYJJGR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.86 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|