C47H45N5O7 — CID 146566298
2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[6-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]-3-pyridinyl]piperazin-1-yl]propoxy]isoindole-1,3-dione (PubChem CID 146566298) has the molecular formula C47H45N5O7 and a molecular weight of 791.91 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[6-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]-3-pyridinyl]piperazin-1-yl]propoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[6-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]-3-pyridinyl]piperazin-1-yl]propoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146566298 |
| Molecular Formula | C47H45N5O7 |
| Molecular Weight | 791.91 g/mol |
| Exact Mass | 791.33 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[6-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]-3-pyridinyl]piperazin-1-yl]propoxy]isoindole-1,3-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(Oc2ccc(N3CCN(CCCOc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)cn2)cc1)c1ccccc1 |
| InChI | InChI=1S/C47H45N5O7/c1-2-38(31-7-4-3-5-8-31)44(32-9-14-35(53)15-10-32)33-11-16-36(17-12-33)59-43-22-13-34(30-48-43)51-26-24-50(25-27-51)23-6-28-58-37-18-19-39-40(29-37)47(57)52(46(39)56)41-20-21-42(54)49-45(41)55/h3-5,7-19,22,29-30,41,53H,2,6,20-21,23-28H2,1H3,(H,49,54,55)/b44-38- |
| InChIKey | AFHHBFFELGIRHA-XUMWXMTGSA-N |
| XLogP | 6.94 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.91 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|