C44H47N5O6 — CID 146566692
2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]propylamino]isoindole-1,3-dione (PubChem CID 146566692) has the molecular formula C44H47N5O6 and a molecular weight of 741.89 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146566692 |
| Molecular Formula | C44H47N5O6 |
| Molecular Weight | 741.89 g/mol |
| Exact Mass | 741.35 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[4-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]propylamino]isoindole-1,3-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCN2CCN(CCCNc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H47N5O6/c1-2-36(30-7-4-3-5-8-30)41(31-9-14-34(50)15-10-31)32-11-16-35(17-12-32)55-28-27-48-25-23-47(24-26-48)22-6-21-45-33-13-18-37-38(29-33)44(54)49(43(37)53)39-19-20-40(51)46-42(39)52/h3-5,7-18,29,39,45,50H,2,6,19-28H2,1H3,(H,46,51,52) |
| InChIKey | NDRPJSGFDOOKGV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.89 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|