C44H46N4O5 — CID 163779018
2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]cyclohexa-2,4-dien-1-ylidene]piperidin-1-yl]butylamino]isoindole-1,3-dione (PubChem CID 163779018) has the molecular formula C44H46N4O5 and a molecular weight of 710.88 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]cyclohexa-2,4-dien-1-ylidene]piperidin-1-yl]butylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]cyclohexa-2,4-dien-1-ylidene]piperidin-1-yl]butylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163779018 |
| Molecular Formula | C44H46N4O5 |
| Molecular Weight | 710.88 g/mol |
| Exact Mass | 710.35 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[4-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]cyclohexa-2,4-dien-1-ylidene]piperidin-1-yl]butylamino]isoindole-1,3-dione |
| SMILES | CC/C(=C(/C1=CCC(=C2CCN(CCCCNc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)C=C1)c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H46N4O5/c1-2-36(31-8-4-3-5-9-31)41(33-14-17-35(49)18-15-33)32-12-10-29(11-13-32)30-22-26-47(27-23-30)25-7-6-24-45-34-16-19-37-38(28-34)44(53)48(43(37)52)39-20-21-40(50)46-42(39)51/h3-5,8-10,12-19,28,39,45,49H,2,6-7,11,20-27H2,1H3,(H,46,50,51)/b41-36+ |
| InChIKey | MMZKPHLXICKDHI-JWBCNFBXSA-N |
| XLogP | 7.29 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.88 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|