C46H53N5O4 — CID 146566980
3-[6-[3-[4-[3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]propyl]-1,4-diazepan-1-yl]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146566980) has the molecular formula C46H53N5O4 and a molecular weight of 739.96 g/mol. Its IUPAC name is 3-[6-[3-[4-[3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]propyl]-1,4-diazepan-1-yl]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-[4-[3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]propyl]-1,4-diazepan-1-yl]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146566980 |
| Molecular Formula | C46H53N5O4 |
| Molecular Weight | 739.96 g/mol |
| Exact Mass | 739.41 |
| IUPAC Name | 3-[6-[3-[4-[3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]propyl]-1,4-diazepan-1-yl]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(CCCN2CCCN(CCCNc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H53N5O4/c1-2-40(34-10-4-3-5-11-34)44(36-16-19-39(52)20-17-36)35-14-12-33(13-15-35)9-6-25-49-27-8-28-50(30-29-49)26-7-24-47-38-18-21-41-37(31-38)32-51(46(41)55)42-22-23-43(53)48-45(42)54/h3-5,10-21,31,42,47,52H,2,6-9,22-30,32H2,1H3,(H,48,53,54) |
| InChIKey | YPHJCNRMOVAADK-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.96 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|