C46H49N3O6 — CID 153118434
3-[6-[4-[1-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperidin-4-yl]-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 153118434) has the molecular formula C46H49N3O6 and a molecular weight of 739.91 g/mol. Its IUPAC name is 3-[6-[4-[1-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperidin-4-yl]-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[1-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperidin-4-yl]-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 153118434 |
| Molecular Formula | C46H49N3O6 |
| Molecular Weight | 739.91 g/mol |
| Exact Mass | 739.36 |
| IUPAC Name | 3-[6-[4-[1-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperidin-4-yl]-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCN2CCC(CC(=O)CCc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H49N3O6/c1-2-40(33-6-4-3-5-7-33)44(34-10-15-37(50)16-11-34)35-12-17-39(18-13-35)55-27-26-48-24-22-32(23-25-48)29-38(51)14-8-31-9-19-41-36(28-31)30-49(46(41)54)42-20-21-43(52)47-45(42)53/h3-7,9-13,15-19,28,32,42,50H,2,8,14,20-27,29-30H2,1H3,(H,47,52,53)/b44-40- |
| InChIKey | VUJFRNQMNYCBJW-ZJWNILRBSA-N |
| XLogP | 7.21 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.91 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|