C46H45N5O6 — CID 146566533
3-[6-[[6-[4-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-3-pyridinyl]oxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146566533) has the molecular formula C46H45N5O6 and a molecular weight of 763.90 g/mol. Its IUPAC name is 3-[6-[[6-[4-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-3-pyridinyl]oxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[6-[4-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-3-pyridinyl]oxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146566533 |
| Molecular Formula | C46H45N5O6 |
| Molecular Weight | 763.90 g/mol |
| Exact Mass | 763.34 |
| IUPAC Name | 3-[6-[[6-[4-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-3-pyridinyl]oxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCN2CCN(c3ccc(Oc4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)cn3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H45N5O6/c1-2-39(31-6-4-3-5-7-31)44(32-8-12-35(52)13-9-32)33-10-14-36(15-11-33)56-27-26-49-22-24-50(25-23-49)42-20-17-38(29-47-42)57-37-16-18-40-34(28-37)30-51(46(40)55)41-19-21-43(53)48-45(41)54/h3-18,20,28-29,41,52H,2,19,21-27,30H2,1H3,(H,48,53,54)/b44-39- |
| InChIKey | PFPHMJOLWDASAC-MLQFJZEUSA-N |
| XLogP | 6.91 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.90 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|