C47H52N4O5 — CID 146566232
3-[6-[1-[1-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperidin-4-yl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146566232) has the molecular formula C47H52N4O5 and a molecular weight of 752.96 g/mol. Its IUPAC name is 3-[6-[1-[1-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperidin-4-yl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[1-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperidin-4-yl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146566232 |
| Molecular Formula | C47H52N4O5 |
| Molecular Weight | 752.96 g/mol |
| Exact Mass | 752.39 |
| IUPAC Name | 3-[6-[1-[1-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperidin-4-yl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCN2CCC(N3CCC(c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C47H52N4O5/c1-2-41(33-6-4-3-5-7-33)45(34-8-13-39(52)14-9-34)35-10-15-40(16-11-35)56-29-28-49-24-22-38(23-25-49)50-26-20-32(21-27-50)36-12-17-42-37(30-36)31-51(47(42)55)43-18-19-44(53)48-46(43)54/h3-17,30,32,38,43,52H,2,18-29,31H2,1H3,(H,48,53,54)/b45-41- |
| InChIKey | NSOIQYHNOCFIQI-INXUWUOZSA-N |
| XLogP | 7.25 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.96 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|