C46H52N4O5 — CID 146566176
3-[6-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]-3,5-dimethylpiperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146566176) has the molecular formula C46H52N4O5 and a molecular weight of 740.95 g/mol. Its IUPAC name is 3-[6-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]-3,5-dimethylpiperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]-3,5-dimethylpiperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146566176 |
| Molecular Formula | C46H52N4O5 |
| Molecular Weight | 740.95 g/mol |
| Exact Mass | 740.39 |
| IUPAC Name | 3-[6-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]-3,5-dimethylpiperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCCCCN2C(C)CN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2C)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H52N4O5/c1-4-40(33-11-7-5-8-12-33)44(34-13-18-38(51)19-14-34)35-15-20-39(21-16-35)55-26-10-6-9-25-49-31(2)28-48(29-32(49)3)37-17-22-41-36(27-37)30-50(46(41)54)42-23-24-43(52)47-45(42)53/h5,7-8,11-22,27,31-32,42,51H,4,6,9-10,23-26,28-30H2,1-3H3,(H,47,52,53)/b44-40- |
| InChIKey | VNKJDGMSDPMKGN-ZJWNILRBSA-N |
| XLogP | 7.67 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.95 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|