C43H44N4O7 — CID 146566530
3-[6-[2-[4-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-2-oxoethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146566530) has the molecular formula C43H44N4O7 and a molecular weight of 728.85 g/mol. Its IUPAC name is 3-[6-[2-[4-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-2-oxoethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[4-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-2-oxoethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146566530 |
| Molecular Formula | C43H44N4O7 |
| Molecular Weight | 728.85 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | 3-[6-[2-[4-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-2-oxoethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCN2CCN(C(=O)COc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H44N4O7/c1-2-36(29-6-4-3-5-7-29)41(30-8-12-33(48)13-9-30)31-10-14-34(15-11-31)53-25-24-45-20-22-46(23-21-45)40(50)28-54-35-16-17-37-32(26-35)27-47(43(37)52)38-18-19-39(49)44-42(38)51/h3-17,26,38,48H,2,18-25,27-28H2,1H3,(H,44,49,51)/b41-36- |
| InChIKey | CONVEZPESHGCKN-GYILVKINSA-N |
| XLogP | 5.12 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.85 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|