C48H55N5O7 — CID 151191273
3-[7-[[7-[4-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-7-oxoheptyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 151191273) has the molecular formula C48H55N5O7 and a molecular weight of 814.00 g/mol. Its IUPAC name is 3-[7-[[7-[4-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-7-oxoheptyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[7-[4-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-7-oxoheptyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 151191273 |
| Molecular Formula | C48H55N5O7 |
| Molecular Weight | 814.00 g/mol |
| Exact Mass | 813.41 |
| IUPAC Name | 3-[7-[[7-[4-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-7-oxoheptyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCN2CCN(C(=O)CCCCCCNc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C48H55N5O7/c1-2-39(33-11-17-36(54)18-12-33)46(34-13-19-37(55)20-14-34)35-15-21-38(22-16-35)60-31-30-51-26-28-52(29-27-51)45(57)10-5-3-4-6-25-49-42-9-7-8-40-41(42)32-53(48(40)59)43-23-24-44(56)50-47(43)58/h7-9,11-22,43,49,54-55H,2-6,10,23-32H2,1H3,(H,50,56,58) |
| InChIKey | NGIYSNMDHQGOJV-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.00 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|