C47H52ClN5O7 — CID 150544984
3-[7-[[6-[4-[2-[4-[4-chloro-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-6-oxohexyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 150544984) has the molecular formula C47H52ClN5O7 and a molecular weight of 834.41 g/mol. Its IUPAC name is 3-[7-[[6-[4-[2-[4-[4-chloro-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-6-oxohexyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[6-[4-[2-[4-[4-chloro-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-6-oxohexyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 150544984 |
| Molecular Formula | C47H52ClN5O7 |
| Molecular Weight | 834.41 g/mol |
| Exact Mass | 833.36 |
| IUPAC Name | 3-[7-[[6-[4-[2-[4-[4-chloro-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-6-oxohexyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(NCCCCCC(=O)N4CCN(CCOc5ccc(C(=C(CCCl)c6ccc(O)cc6)c6ccc(O)cc6)cc5)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C47H52ClN5O7/c48-23-22-38(32-8-14-35(54)15-9-32)45(33-10-16-36(55)17-11-33)34-12-18-37(19-13-34)60-30-29-51-25-27-52(28-26-51)44(57)7-2-1-3-24-49-41-6-4-5-39-40(41)31-53(47(39)59)42-20-21-43(56)50-46(42)58/h4-6,8-19,42,49,54-55H,1-3,7,20-31H2,(H,50,56,58) |
| InChIKey | IGRCZKLAHPVBKL-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.41 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|